CAS 733719-74-9 is the registry number for 7-Chloro-2-methyl-quinoline-3-carboxylic acid ethyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
Ethyl 7-chloro-2-methylquinoline-3-carboxylate (CAS 733719-74-9) is a chemical compound with the molecular formula C13H12ClNO2 and a molecular weight of 249.69 g/mol. IUPAC name: ethyl 7-chloro-2-methylquinoline-3-carboxylate. InChIKey: IQMPORCGKAHSDX-UHFFFAOYSA-N.
| Molecular formula | C13H12ClNO2 |
|---|---|
| Molecular weight | 249.69 g/mol |
| IUPAC name | ethyl 7-chloro-2-methylquinoline-3-carboxylate |
| InChIKey | IQMPORCGKAHSDX-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N=C2C=C(C=CC2=C1)Cl)C |
Computed by PubChem (NCBI)