Products 733719-74-9

CAS 733719-74-9 is the registry number for 7-Chloro-2-methyl-quinoline-3-carboxylic acid ethyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

Ethyl 7-chloro-2-methylquinoline-3-carboxylate (CAS 733719-74-9) is a chemical compound with the molecular formula C13H12ClNO2 and a molecular weight of 249.69 g/mol. IUPAC name: ethyl 7-chloro-2-methylquinoline-3-carboxylate. InChIKey: IQMPORCGKAHSDX-UHFFFAOYSA-N.

Identity
Molecular formulaC13H12ClNO2
Molecular weight249.69 g/mol
IUPAC nameethyl 7-chloro-2-methylquinoline-3-carboxylate
InChIKeyIQMPORCGKAHSDX-UHFFFAOYSA-N
SMILESCCOC(=O)C1=C(N=C2C=C(C=CC2=C1)Cl)C

Computed by PubChem (NCBI)