CAS 1133116-23-0 is the registry number for Ethyl 1-tosyl-1H-imidazole-4-carboxylate, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
Ethyl 1-(4-methylphenyl)sulfonylimidazole-4-carboxylate (CAS 1133116-23-0) is a chemical compound with the molecular formula C13H14N2O4S and a molecular weight of 294.33 g/mol. IUPAC name: ethyl 1-(4-methylphenyl)sulfonylimidazole-4-carboxylate. InChIKey: JPZDAOZAKPSNLV-UHFFFAOYSA-N.
| Molecular formula | C13H14N2O4S |
|---|---|
| Molecular weight | 294.33 g/mol |
| IUPAC name | ethyl 1-(4-methylphenyl)sulfonylimidazole-4-carboxylate |
| InChIKey | JPZDAOZAKPSNLV-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CN(C=N1)S(=O)(=O)C2=CC=C(C=C2)C |
Computed by PubChem (NCBI)