CAS 1775534-50-3 is the registry number for 5-Methyl-2-(2-phenylethyl)-2h-1,2,6-thiadiazine-4-carboxylic acid 1,1-dioxide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.
5-methyl-1,1-dioxo-2-(2-phenylethyl)-1,2,6-thiadiazine-4-carboxylic acid (CAS 1775534-50-3) is a chemical compound with the molecular formula C13H14N2O4S and a molecular weight of 294.33 g/mol. IUPAC name: 5-methyl-1,1-dioxo-2-(2-phenylethyl)-1,2,6-thiadiazine-4-carboxylic acid. InChIKey: OCGHIDASSDPYRH-UHFFFAOYSA-N.
| Molecular formula | C13H14N2O4S |
|---|---|
| Molecular weight | 294.33 g/mol |
| IUPAC name | 5-methyl-1,1-dioxo-2-(2-phenylethyl)-1,2,6-thiadiazine-4-carboxylic acid |
| InChIKey | OCGHIDASSDPYRH-UHFFFAOYSA-N |
| SMILES | CC1=NS(=O)(=O)N(C=C1C(=O)O)CCC2=CC=CC=C2 |
Computed by PubChem (NCBI)