Products 871478-84-1
CAS 871478-84-1 appears in our catalog under these names: 1-(4-Cyanobenzenesulfonyl)piperidine-4-carboxylic acid, 1-[(4-Cyanophenyl)sulfonyl]piperidine-4-carboxylic acid, 95%. Offered by: Biosynth, Combi-blocks. Available pack sizes: 0,5g, 5g, 1g, 250mg.
1-(4-cyanophenyl)sulfonylpiperidine-4-carboxylic acid (CAS 871478-84-1) is a chemical compound with the molecular formula C13H14N2O4S and a molecular weight of 294.33 g/mol. IUPAC name: 1-(4-cyanophenyl)sulfonylpiperidine-4-carboxylic acid. InChIKey: ZQEBOWPRCWAPOI-UHFFFAOYSA-N.
| Molecular formula | C13H14N2O4S |
|---|---|
| Molecular weight | 294.33 g/mol |
| IUPAC name | 1-(4-cyanophenyl)sulfonylpiperidine-4-carboxylic acid |
| InChIKey | ZQEBOWPRCWAPOI-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1C(=O)O)S(=O)(=O)C2=CC=C(C=C2)C#N |
Computed by PubChem (NCBI)