CAS 1775525-86-4 is the registry number for 5-Methyl-2-(3-methylbenzyl)-2h-1,2,6-thiadiazine-4-carboxylic acid 1,1-dioxide, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
5-methyl-2-[(3-methylphenyl)methyl]-1,1-dioxo-1,2,6-thiadiazine-4-carboxylic acid (CAS 1775525-86-4) is a chemical compound with the molecular formula C13H14N2O4S and a molecular weight of 294.33 g/mol. IUPAC name: 5-methyl-2-[(3-methylphenyl)methyl]-1,1-dioxo-1,2,6-thiadiazine-4-carboxylic acid. InChIKey: XMZYXFCLVHGYTR-UHFFFAOYSA-N.
| Molecular formula | C13H14N2O4S |
|---|---|
| Molecular weight | 294.33 g/mol |
| IUPAC name | 5-methyl-2-[(3-methylphenyl)methyl]-1,1-dioxo-1,2,6-thiadiazine-4-carboxylic acid |
| InChIKey | XMZYXFCLVHGYTR-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)CN2C=C(C(=NS2(=O)=O)C)C(=O)O |
Computed by PubChem (NCBI)