CAS 1325305-12-1 is the registry number for Methyl 3-amino-1-methyl-4-(phenylsulfonyl)-1h-pyrrole-2-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg.
Methyl 3-amino-4-(benzenesulfonyl)-1-methylpyrrole-2-carboxylate (CAS 1325305-12-1) is a chemical compound with the molecular formula C13H14N2O4S and a molecular weight of 294.33 g/mol. IUPAC name: methyl 3-amino-4-(benzenesulfonyl)-1-methylpyrrole-2-carboxylate. InChIKey: YYVYITATCMOKFC-UHFFFAOYSA-N.
| Molecular formula | C13H14N2O4S |
|---|---|
| Molecular weight | 294.33 g/mol |
| IUPAC name | methyl 3-amino-4-(benzenesulfonyl)-1-methylpyrrole-2-carboxylate |
| InChIKey | YYVYITATCMOKFC-UHFFFAOYSA-N |
| SMILES | CN1C=C(C(=C1C(=O)OC)N)S(=O)(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)