CAS 113364-57-1 appears in our catalog under these names: 3–Bromo–1–Indan–5–Yl–Propan–1–One, 3-Bromo-1-indan-5-yl-propan-1-one, 95%. Offered by: GLPBio, Combi-blocks, Fluorochem. Available pack sizes: 100mg, 1g, 250mg.
3-bromo-1-(2,3-dihydro-1H-inden-5-yl)propan-1-one (CAS 113364-57-1) is a chemical compound with the molecular formula C12H13BrO and a molecular weight of 253.13 g/mol. IUPAC name: 3-bromo-1-(2,3-dihydro-1H-inden-5-yl)propan-1-one. InChIKey: VUQOQAUOKOWPMU-UHFFFAOYSA-N.
| Molecular formula | C12H13BrO |
|---|---|
| Molecular weight | 253.13 g/mol |
| IUPAC name | 3-bromo-1-(2,3-dihydro-1H-inden-5-yl)propan-1-one |
| InChIKey | VUQOQAUOKOWPMU-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C1)C=C(C=C2)C(=O)CCBr |
Computed by PubChem (NCBI)