CAS 2204-97-9 is the registry number for (4-Bromophenyl)(cyclopentyl)methanone 95+%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
(4-bromophenyl)-cyclopentylmethanone (CAS 2204-97-9) is a chemical compound with the molecular formula C12H13BrO and a molecular weight of 253.13 g/mol. IUPAC name: (4-bromophenyl)-cyclopentylmethanone. InChIKey: IQQVNZBTCJEXKS-UHFFFAOYSA-N.
| Molecular formula | C12H13BrO |
|---|---|
| Molecular weight | 253.13 g/mol |
| IUPAC name | (4-bromophenyl)-cyclopentylmethanone |
| InChIKey | IQQVNZBTCJEXKS-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)C(=O)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)