Products 1655577-26-6
CAS 1655577-26-6 is the registry number for 5-Bromo-2,2-dimethyl-3,4-dihydronaphthalen-1(2H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-bromo-2,2-dimethyl-3,4-dihydronaphthalen-1-one (CAS 1655577-26-6) is a chemical compound with the molecular formula C12H13BrO and a molecular weight of 253.13 g/mol. IUPAC name: 5-bromo-2,2-dimethyl-3,4-dihydronaphthalen-1-one. InChIKey: AMKWVVTYEYMOAV-UHFFFAOYSA-N.
| Molecular formula | C12H13BrO |
|---|---|
| Molecular weight | 253.13 g/mol |
| IUPAC name | 5-bromo-2,2-dimethyl-3,4-dihydronaphthalen-1-one |
| InChIKey | AMKWVVTYEYMOAV-UHFFFAOYSA-N |
| SMILES | CC1(CCC2=C(C1=O)C=CC=C2Br)C |
Computed by PubChem (NCBI)