Products 94523-18-9
CAS 94523-18-9 is the registry number for 2-Bromo-7,8,9,10-tetrahydrobenzo[8]annulen-5(6H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-bromo-7,8,9,10-tetrahydro-6H-benzo[8]annulen-5-one (CAS 94523-18-9) is a chemical compound with the molecular formula C12H13BrO and a molecular weight of 253.13 g/mol. IUPAC name: 2-bromo-7,8,9,10-tetrahydro-6H-benzo[8]annulen-5-one. InChIKey: LTBIRNWXDHAINT-UHFFFAOYSA-N.
| Molecular formula | C12H13BrO |
|---|---|
| Molecular weight | 253.13 g/mol |
| IUPAC name | 2-bromo-7,8,9,10-tetrahydro-6H-benzo[8]annulen-5-one |
| InChIKey | LTBIRNWXDHAINT-UHFFFAOYSA-N |
| SMILES | C1CCC2=C(C=CC(=C2)Br)C(=O)CC1 |
Computed by PubChem (NCBI)