Products 2581065-43-0
CAS 2581065-43-0 is the registry number for 6'-bromospiro[oxetane-3,1'-tetralin], 95%. Offered by: Chemat Brand. Available pack sizes: on request.
7-bromospiro[2,3-dihydro-1H-naphthalene-4,3'-oxetane] (CAS 2581065-43-0) is a chemical compound with the molecular formula C12H13BrO and a molecular weight of 253.13 g/mol. IUPAC name: 7-bromospiro[2,3-dihydro-1H-naphthalene-4,3'-oxetane]. InChIKey: XSAHTVPBOSFZRL-UHFFFAOYSA-N.
| Molecular formula | C12H13BrO |
|---|---|
| Molecular weight | 253.13 g/mol |
| IUPAC name | 7-bromospiro[2,3-dihydro-1H-naphthalene-4,3'-oxetane] |
| InChIKey | XSAHTVPBOSFZRL-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C=CC(=C2)Br)C3(C1)COC3 |
Computed by PubChem (NCBI)