CAS 1134113-37-3 is the registry number for 4-Nitrophenyl oxetan-3-yl carbonate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
(4-nitrophenyl) oxetan-3-yl carbonate (CAS 1134113-37-3) is a chemical compound with the molecular formula C10H9NO6 and a molecular weight of 239.18 g/mol. IUPAC name: (4-nitrophenyl) oxetan-3-yl carbonate. InChIKey: UKTIQWPDFBYXTR-UHFFFAOYSA-N.
| Molecular formula | C10H9NO6 |
|---|---|
| Molecular weight | 239.18 g/mol |
| IUPAC name | (4-nitrophenyl) oxetan-3-yl carbonate |
| InChIKey | UKTIQWPDFBYXTR-UHFFFAOYSA-N |
| SMILES | C1C(CO1)OC(=O)OC2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)