Products 16792-46-4

CAS 16792-46-4 is the registry number for 3-(4-Methoxy-2-nitrophenyl)-2-oxopropanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

3-(4-methoxy-2-nitrophenyl)-2-oxopropanoic acid (CAS 16792-46-4) is a chemical compound with the molecular formula C10H9NO6 and a molecular weight of 239.18 g/mol. IUPAC name: 3-(4-methoxy-2-nitrophenyl)-2-oxopropanoic acid. InChIKey: RTDWIZDMTVYHFY-UHFFFAOYSA-N.

Identity
Molecular formulaC10H9NO6
Molecular weight239.18 g/mol
IUPAC name3-(4-methoxy-2-nitrophenyl)-2-oxopropanoic acid
InChIKeyRTDWIZDMTVYHFY-UHFFFAOYSA-N
SMILESCOC1=CC(=C(C=C1)CC(=O)C(=O)O)[N+](=O)[O-]

Computed by PubChem (NCBI)