CAS 2698-69-3 appears in our catalog under these names: 4–Formyl–2–methoxy–3–nitrophenyl acetate, 4-formyl-2-methoxy-3-nitrophenyl acetate, 4-Formyl-2-methoxy-3-nitrophenyl acetate, 95%, 4-Formyl-2-methoxy-3-nitrophenyl acetate 95+%, 4-Formyl-2-methoxy-3-nitrophenyl acetate, 95+%, 95+%. Offered by: GLPBio, Biosynth, Combi-blocks, Ambeed, Fluorochem. Available pack sizes: 100mg, 2,5g, 250mg, 1g, 5g.
(4-formyl-2-methoxy-3-nitrophenyl) acetate (CAS 2698-69-3) is a chemical compound with the molecular formula C10H9NO6 and a molecular weight of 239.18 g/mol. IUPAC name: (4-formyl-2-methoxy-3-nitrophenyl) acetate. InChIKey: HCFBQKXQWQSMNV-UHFFFAOYSA-N.
| Molecular formula | C10H9NO6 |
|---|---|
| Molecular weight | 239.18 g/mol |
| IUPAC name | (4-formyl-2-methoxy-3-nitrophenyl) acetate |
| InChIKey | HCFBQKXQWQSMNV-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=C(C(=C(C=C1)C=O)[N+](=O)[O-])OC |
Computed by PubChem (NCBI)