Products 4435-99-8

CAS 4435-99-8 is the registry number for 4-((Carboxymethyl)amino)isophthalic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

4-(carboxymethylamino)benzene-1,3-dicarboxylic acid (CAS 4435-99-8) is a chemical compound with the molecular formula C10H9NO6 and a molecular weight of 239.18 g/mol. IUPAC name: 4-(carboxymethylamino)benzene-1,3-dicarboxylic acid. InChIKey: RGJWPDKBCQVLNQ-UHFFFAOYSA-N.

Identity
Molecular formulaC10H9NO6
Molecular weight239.18 g/mol
IUPAC name4-(carboxymethylamino)benzene-1,3-dicarboxylic acid
InChIKeyRGJWPDKBCQVLNQ-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1C(=O)O)C(=O)O)NCC(=O)O

Computed by PubChem (NCBI)