Products 22871-55-2
CAS 22871-55-2 appears in our catalog under these names: 5-Nitroisophthalic acid monoethyl ester, 98%, Monoethyl 5–Nitroisophthalate, Monoethyl 5-Nitroisophthalate, >98.0%(GC)(T), 5-Nitroisophthalic acid monoethyl ester, 5-NITROISOPHTHALIC ACID MONOETHYL ESTER, 98.0%, 98.0%. Offered by: Combi-blocks, GLPBio, TCI, Biosynth, Chemat. Available pack sizes: 25g, 100g, 1g, 5g, 500g, 10g.
3-ethoxycarbonyl-5-nitrobenzoic acid (CAS 22871-55-2) is a chemical compound with the molecular formula C10H9NO6 and a molecular weight of 239.18 g/mol. IUPAC name: 3-ethoxycarbonyl-5-nitrobenzoic acid. InChIKey: HOYHBDFTELAGGG-UHFFFAOYSA-N.
| Molecular formula | C10H9NO6 |
|---|---|
| Molecular weight | 239.18 g/mol |
| IUPAC name | 3-ethoxycarbonyl-5-nitrobenzoic acid |
| InChIKey | HOYHBDFTELAGGG-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=CC(=C1)C(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)
Synonyms:
5-Nitroisophthalic acid, monoethyl ester, Ethyl hydrogen 5-nitroisophthalate, 1,3-Benzenedicarboxylic acid, 5-nitro-, 1-ethyl ester, 1,3-Benzenedicarboxylic acid, 5-nitro-, monoethyl ester, 5-Nitroisophthalic Acid Monoethyl Ester, Monoethyl 5-nitroisophthalate, 3-(ethoxycarbonyl)-5-nitrobenzoic acid, 3-ethoxycarbonyl-5-nitrobenzoic acid, Ethyl 3-carboxy-5-nitrobenzoate, ethyl hydrogen 5-nitro-isophthalate