Products 113421-97-9
CAS 113421-97-9 is the registry number for 1-Chloro-4-nitro-2-(trifluoromethoxy)benzene, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
1-chloro-4-nitro-2-(trifluoromethoxy)benzene (CAS 113421-97-9) is a chemical compound with the molecular formula C7H3ClF3NO3 and a molecular weight of 241.55 g/mol. IUPAC name: 1-chloro-4-nitro-2-(trifluoromethoxy)benzene. InChIKey: WVRGIODBGXCYRU-UHFFFAOYSA-N.
| Molecular formula | C7H3ClF3NO3 |
|---|---|
| Molecular weight | 241.55 g/mol |
| IUPAC name | 1-chloro-4-nitro-2-(trifluoromethoxy)benzene |
| InChIKey | WVRGIODBGXCYRU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])OC(F)(F)F)Cl |
Computed by PubChem (NCBI)