Products 1261570-83-5
CAS 1261570-83-5 is the registry number for 1-Chloro-3-nitro-2-(trifluoromethoxy)benzene, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
1-chloro-3-nitro-2-(trifluoromethoxy)benzene (CAS 1261570-83-5) is a chemical compound with the molecular formula C7H3ClF3NO3 and a molecular weight of 241.55 g/mol. IUPAC name: 1-chloro-3-nitro-2-(trifluoromethoxy)benzene. InChIKey: LWLCRRUIYBNYLC-UHFFFAOYSA-N.
| Molecular formula | C7H3ClF3NO3 |
|---|---|
| Molecular weight | 241.55 g/mol |
| IUPAC name | 1-chloro-3-nitro-2-(trifluoromethoxy)benzene |
| InChIKey | LWLCRRUIYBNYLC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)OC(F)(F)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)