Products 1221172-04-8
CAS 1221172-04-8 appears in our catalog under these names: 2-Chloro-6-(trifluoromethoxy)nicotinic acid, 95%, 2-Chloro-6-(trifluoromethoxy)nicotinic acid, 95+%, 3-Pyridinecarboxylic acid, 2-chloro-6-(trifluoromethoxy)-, 95%. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
2-chloro-6-(trifluoromethoxy)pyridine-3-carboxylic acid (CAS 1221172-04-8) is a chemical compound with the molecular formula C7H3ClF3NO3 and a molecular weight of 241.55 g/mol. IUPAC name: 2-chloro-6-(trifluoromethoxy)pyridine-3-carboxylic acid. InChIKey: PKESEAIWVBVHEB-UHFFFAOYSA-N.
| Molecular formula | C7H3ClF3NO3 |
|---|---|
| Molecular weight | 241.55 g/mol |
| IUPAC name | 2-chloro-6-(trifluoromethoxy)pyridine-3-carboxylic acid |
| InChIKey | PKESEAIWVBVHEB-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1C(=O)O)Cl)OC(F)(F)F |
Computed by PubChem (NCBI)