Products 1221171-91-0
CAS 1221171-91-0 appears in our catalog under these names: 6-Chloro-2-(trifluoromethoxy)nicotinic acid, 95%, 6-Chloro-2-(trifluoromethoxy)nicotinic acid, 98%. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 250mg, 1g, 5g.
6-chloro-2-(trifluoromethoxy)pyridine-3-carboxylic acid (CAS 1221171-91-0) is a chemical compound with the molecular formula C7H3ClF3NO3 and a molecular weight of 241.55 g/mol. IUPAC name: 6-chloro-2-(trifluoromethoxy)pyridine-3-carboxylic acid. InChIKey: OMGPEKLXZHLEDL-UHFFFAOYSA-N.
| Molecular formula | C7H3ClF3NO3 |
|---|---|
| Molecular weight | 241.55 g/mol |
| IUPAC name | 6-chloro-2-(trifluoromethoxy)pyridine-3-carboxylic acid |
| InChIKey | OMGPEKLXZHLEDL-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1C(=O)O)OC(F)(F)F)Cl |
Computed by PubChem (NCBI)