CAS 588-09-0 appears in our catalog under these names: 1-Chloro-2-nitro-4-(trifluoromethoxy)benzene 97%, 1-Chloro-2-nitro-4-(trifluoromethoxy)benzene, 98%, 98%, 1-Chloro-2-nitro-4-(trifluoromethoxy)benzene, 95%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 100g, 500g, 1000g, 5g, 10g, 1kg, 1g.
1-chloro-2-nitro-4-(trifluoromethoxy)benzene (CAS 588-09-0) is a chemical compound with the molecular formula C7H3ClF3NO3 and a molecular weight of 241.55 g/mol. IUPAC name: 1-chloro-2-nitro-4-(trifluoromethoxy)benzene. InChIKey: WMEHRJJXMQRTOU-UHFFFAOYSA-N.
| Molecular formula | C7H3ClF3NO3 |
|---|---|
| Molecular weight | 241.55 g/mol |
| IUPAC name | 1-chloro-2-nitro-4-(trifluoromethoxy)benzene |
| InChIKey | WMEHRJJXMQRTOU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1OC(F)(F)F)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)