CAS 31105-93-8 appears in our catalog under these names: 2,4-Difluoro-l-phenylalanine, 98%, (S)–2–Amino–3–(2,4–difluorophenyl)propanoic acid, (S)-2-Amino-3-(2,4-difluorophenyl)propanoic acid, 97%, 97%, (S)-2-Amino-3-(2,4-difluorophenyl)propanoic acid, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 10g, 25g, 5g, 1g, 250mg.
(2S)-2-amino-3-(2,4-difluorophenyl)propanoic acid (CAS 31105-93-8) is a chemical compound with the molecular formula C9H9F2NO2 and a molecular weight of 201.17 g/mol. IUPAC name: (2S)-2-amino-3-(2,4-difluorophenyl)propanoic acid. InChIKey: UEFLPVKMPDEMFW-QMMMGPOBSA-N.
| Molecular formula | C9H9F2NO2 |
|---|---|
| Molecular weight | 201.17 g/mol |
| IUPAC name | (2S)-2-amino-3-(2,4-difluorophenyl)propanoic acid |
| InChIKey | UEFLPVKMPDEMFW-QMMMGPOBSA-N |
| SMILES | C1=CC(=C(C=C1F)F)C[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)