CAS 236754-62-4 appears in our catalog under these names: 2,3-Difluoro-dl-phenylalanine, 95%, 2-Amino-3-(2,3-difluorophenyl)propanoic acid, 97%, 2-Amino-3-(2,3-difluorophenyl)propanoic acid, 95%, 95%, dl-2,3-Difluorophenylalanine, 97%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg.
2-amino-3-(2,3-difluorophenyl)propanoic acid (CAS 236754-62-4) is a chemical compound with the molecular formula C9H9F2NO2 and a molecular weight of 201.17 g/mol. IUPAC name: 2-amino-3-(2,3-difluorophenyl)propanoic acid. InChIKey: KSUXKFDPNKLPHX-UHFFFAOYSA-N.
| Molecular formula | C9H9F2NO2 |
|---|---|
| Molecular weight | 201.17 g/mol |
| IUPAC name | 2-amino-3-(2,3-difluorophenyl)propanoic acid |
| InChIKey | KSUXKFDPNKLPHX-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)F)CC(C(=O)O)N |
Computed by PubChem (NCBI)