CAS 32133-38-3 appears in our catalog under these names: 2,5-Difluoro-dl-phenylalanine, 97%, dl–2,5–Difluorophenylalanine, 2-Amino-3-(2,5-difluorophenyl)propanoic acid, 97%, 97%, dl-2,5-Difluorophenylalanine, 97%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 500mg, 100mg, 10g, 25g, 50g.
2-amino-3-(2,5-difluorophenyl)propanoic acid (CAS 32133-38-3) is a chemical compound with the molecular formula C9H9F2NO2 and a molecular weight of 201.17 g/mol. IUPAC name: 2-amino-3-(2,5-difluorophenyl)propanoic acid. InChIKey: YHYQITHAFYELNW-UHFFFAOYSA-N.
| Molecular formula | C9H9F2NO2 |
|---|---|
| Molecular weight | 201.17 g/mol |
| IUPAC name | 2-amino-3-(2,5-difluorophenyl)propanoic acid |
| InChIKey | YHYQITHAFYELNW-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)CC(C(=O)O)N)F |
Computed by PubChem (NCBI)