Products 1134714-88-7
CAS 1134714-88-7 is the registry number for 1-(1,1-Dioxothiolan-3-yl)pyrazole-4-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-(1,1-dioxothiolan-3-yl)pyrazole-4-carboxylic acid (CAS 1134714-88-7) is a chemical compound with the molecular formula C8H10N2O4S and a molecular weight of 230.24 g/mol. IUPAC name: 1-(1,1-dioxothiolan-3-yl)pyrazole-4-carboxylic acid. InChIKey: NIDLOHKMRFEPHX-UHFFFAOYSA-N.
| Molecular formula | C8H10N2O4S |
|---|---|
| Molecular weight | 230.24 g/mol |
| IUPAC name | 1-(1,1-dioxothiolan-3-yl)pyrazole-4-carboxylic acid |
| InChIKey | NIDLOHKMRFEPHX-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)CC1N2C=C(C=N2)C(=O)O |
Computed by PubChem (NCBI)