CAS 1134818-07-7 is the registry number for 1-(2,4-Difluorophenyl)-3,5-dimethyl-1H-pyrazole-4-carbaldehyde, 95%. Offered by: AmBeed. Available pack sizes: 5g.
1-(2,4-difluorophenyl)-3,5-dimethylpyrazole-4-carbaldehyde (CAS 1134818-07-7) is a chemical compound with the molecular formula C12H10F2N2O and a molecular weight of 236.22 g/mol. IUPAC name: 1-(2,4-difluorophenyl)-3,5-dimethylpyrazole-4-carbaldehyde. InChIKey: INEVOTSMFVMARO-UHFFFAOYSA-N.
| Molecular formula | C12H10F2N2O |
|---|---|
| Molecular weight | 236.22 g/mol |
| IUPAC name | 1-(2,4-difluorophenyl)-3,5-dimethylpyrazole-4-carbaldehyde |
| InChIKey | INEVOTSMFVMARO-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1C2=C(C=C(C=C2)F)F)C)C=O |
Computed by PubChem (NCBI)