CAS 151411-13-1 is the registry number for 2-Pyridinamine, 3-[(2,6-difluorophenyl)methoxy]-, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
3-[(2,6-difluorophenyl)methoxy]pyridin-2-amine (CAS 151411-13-1) is a chemical compound with the molecular formula C12H10F2N2O and a molecular weight of 236.22 g/mol. IUPAC name: 3-[(2,6-difluorophenyl)methoxy]pyridin-2-amine. InChIKey: LBZQPIOLPBOVRI-UHFFFAOYSA-N.
| Molecular formula | C12H10F2N2O |
|---|---|
| Molecular weight | 236.22 g/mol |
| IUPAC name | 3-[(2,6-difluorophenyl)methoxy]pyridin-2-amine |
| InChIKey | LBZQPIOLPBOVRI-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)COC2=C(N=CC=C2)N)F |
Computed by PubChem (NCBI)