Products 2096985-50-9
CAS 2096985-50-9 is the registry number for 1-[1-(3,5-Difluorophenyl)-3-methyl-1h-pyrazol-4-yl]ethanone, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
1-[1-(3,5-difluorophenyl)-3-methylpyrazol-4-yl]ethanone (CAS 2096985-50-9) is a chemical compound with the molecular formula C12H10F2N2O and a molecular weight of 236.22 g/mol. IUPAC name: 1-[1-(3,5-difluorophenyl)-3-methylpyrazol-4-yl]ethanone. InChIKey: XNPOLOKMIZAECE-UHFFFAOYSA-N.
| Molecular formula | C12H10F2N2O |
|---|---|
| Molecular weight | 236.22 g/mol |
| IUPAC name | 1-[1-(3,5-difluorophenyl)-3-methylpyrazol-4-yl]ethanone |
| InChIKey | XNPOLOKMIZAECE-UHFFFAOYSA-N |
| SMILES | CC1=NN(C=C1C(=O)C)C2=CC(=CC(=C2)F)F |
Computed by PubChem (NCBI)