CAS 2328103-09-7 is the registry number for 3-(2,4-Difluorophenyl)-4,5,6,7-tetrahydroisoxazolo[4,3-c]pyridine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(2,4-difluorophenyl)-4,5,6,7-tetrahydro-[1,2]oxazolo[4,3-c]pyridine (CAS 2328103-09-7) is a chemical compound with the molecular formula C12H10F2N2O and a molecular weight of 236.22 g/mol. IUPAC name: 3-(2,4-difluorophenyl)-4,5,6,7-tetrahydro-[1,2]oxazolo[4,3-c]pyridine. InChIKey: ASTWQRAJPIYHSN-UHFFFAOYSA-N.
| Molecular formula | C12H10F2N2O |
|---|---|
| Molecular weight | 236.22 g/mol |
| IUPAC name | 3-(2,4-difluorophenyl)-4,5,6,7-tetrahydro-[1,2]oxazolo[4,3-c]pyridine |
| InChIKey | ASTWQRAJPIYHSN-UHFFFAOYSA-N |
| SMILES | C1CNCC2=C(ON=C21)C3=C(C=C(C=C3)F)F |
Computed by PubChem (NCBI)