Products 2899345-64-1
CAS 2899345-64-1 is the registry number for 1-(3-(1,1-Difluoroethyl)quinoxalin-6-yl)ethan-1-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-[3-(1,1-difluoroethyl)quinoxalin-6-yl]ethanone (CAS 2899345-64-1) is a chemical compound with the molecular formula C12H10F2N2O and a molecular weight of 236.22 g/mol. IUPAC name: 1-[3-(1,1-difluoroethyl)quinoxalin-6-yl]ethanone. InChIKey: DDHAMDXKFBIFJR-UHFFFAOYSA-N.
| Molecular formula | C12H10F2N2O |
|---|---|
| Molecular weight | 236.22 g/mol |
| IUPAC name | 1-[3-(1,1-difluoroethyl)quinoxalin-6-yl]ethanone |
| InChIKey | DDHAMDXKFBIFJR-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC2=NC(=CN=C2C=C1)C(C)(F)F |
Computed by PubChem (NCBI)