CAS 113525-91-0 is the registry number for (2S,3S)-Methyl 2-((tert-butoxycarbonyl)amino)-3-hydroxybutanoate 95+%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
Methyl (2S,3S)-3-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate (CAS 113525-91-0) is a chemical compound with the molecular formula C10H19NO5 and a molecular weight of 233.26 g/mol. IUPAC name: methyl (2S,3S)-3-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate. InChIKey: MZMWAPNVRMDIPS-BQBZGAKWSA-N.
| Molecular formula | C10H19NO5 |
|---|---|
| Molecular weight | 233.26 g/mol |
| IUPAC name | methyl (2S,3S)-3-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
| InChIKey | MZMWAPNVRMDIPS-BQBZGAKWSA-N |
| SMILES | C[C@@H]([C@@H](C(=O)OC)NC(=O)OC(C)(C)C)O |
Computed by PubChem (NCBI)