Products 1135818-89-1
CAS 1135818-89-1 is the registry number for 2-Amino-2-(4-(pyridin-2-yl)phenyl)acetic acid hydrochloride, ≥95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-amino-2-(4-pyridin-2-ylphenyl)acetic acid;hydrochloride (CAS 1135818-89-1) is a chemical compound with the molecular formula C13H13ClN2O2 and a molecular weight of 264.71 g/mol. IUPAC name: 2-amino-2-(4-pyridin-2-ylphenyl)acetic acid;hydrochloride. InChIKey: GKXPBGOAJCCGJQ-UHFFFAOYSA-N.
| Molecular formula | C13H13ClN2O2 |
|---|---|
| Molecular weight | 264.71 g/mol |
| IUPAC name | 2-amino-2-(4-pyridin-2-ylphenyl)acetic acid;hydrochloride |
| InChIKey | GKXPBGOAJCCGJQ-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)C2=CC=C(C=C2)C(C(=O)O)N.Cl |
Computed by PubChem (NCBI)