Products 113639-01-3
CAS 113639-01-3 appears in our catalog under these names: 5-Aminolevulinic-13C2,15N Acid Hydrochloride Salt, 5-Aminolevulinic acid-13C2,15N (hydrochloride), 99.94%. Offered by: TRC, MedChemExpress. Available pack sizes: 5mg, 1 mg.
5-(15N)azanyl-4-oxo(4,5-13C2)pentanoic acid;hydrochloride (CAS 113639-01-3) is a chemical compound with the molecular formula C5H10ClNO3 and a molecular weight of 170.57 g/mol. IUPAC name: 5-(15N)azanyl-4-oxo(4,5-13C2)pentanoic acid;hydrochloride. InChIKey: ZLHFONARZHCSET-MBIZCHBVSA-N.
| Molecular formula | C5H10ClNO3 |
|---|---|
| Molecular weight | 170.57 g/mol |
| IUPAC name | 5-(15N)azanyl-4-oxo(4,5-13C2)pentanoic acid;hydrochloride |
| InChIKey | ZLHFONARZHCSET-MBIZCHBVSA-N |
| SMILES | C(C[13C](=O)[13CH2][15NH2])C(=O)O.Cl |
Computed by PubChem (NCBI)