Products 129720-95-2

CAS 129720-95-2 is the registry number for 5-Aminolevulinic Acid-3-13C Hydrochloride, >95% (HPLC). Offered by: TRC. Available pack sizes: 0,5mg, 5mg.

Structural formula: {0} (CAS {1})

5-amino-4-oxo(313C)pentanoic acid;hydrochloride (CAS 129720-95-2) is a chemical compound with the molecular formula C5H10ClNO3 and a molecular weight of 168.58 g/mol. IUPAC name: 5-amino-4-oxo(313C)pentanoic acid;hydrochloride. InChIKey: ZLHFONARZHCSET-YTBWXGASSA-N.

Identity
Molecular formulaC5H10ClNO3
Molecular weight168.58 g/mol
IUPAC name5-amino-4-oxo(313C)pentanoic acid;hydrochloride
InChIKeyZLHFONARZHCSET-YTBWXGASSA-N
SMILESC([13CH2]C(=O)CN)C(=O)O.Cl

Computed by PubChem (NCBI)