CAS 129720-95-2 is the registry number for 5-Aminolevulinic Acid-3-13C Hydrochloride, >95% (HPLC). Offered by: TRC. Available pack sizes: 0,5mg, 5mg.
5-amino-4-oxo(313C)pentanoic acid;hydrochloride (CAS 129720-95-2) is a chemical compound with the molecular formula C5H10ClNO3 and a molecular weight of 168.58 g/mol. IUPAC name: 5-amino-4-oxo(313C)pentanoic acid;hydrochloride. InChIKey: ZLHFONARZHCSET-YTBWXGASSA-N.
| Molecular formula | C5H10ClNO3 |
|---|---|
| Molecular weight | 168.58 g/mol |
| IUPAC name | 5-amino-4-oxo(313C)pentanoic acid;hydrochloride |
| InChIKey | ZLHFONARZHCSET-YTBWXGASSA-N |
| SMILES | C([13CH2]C(=O)CN)C(=O)O.Cl |
Computed by PubChem (NCBI)