Products 1196157-79-5
CAS 1196157-79-5 appears in our catalog under these names: 5-Aminolevulinic-13C5-15N Acid Hydrochloride, 5-Aminolevulinic-13C5-15N Acid Hydrochloride, >95% (HPLC). Offered by: Chemat, TRC. Available pack sizes: 10mg, 0,5mg, 2,5mg, 5mg.
5-(15N)azanyl-4-oxo(1,2,3,4,5-13C5)pentanoic acid;hydrochloride (CAS 1196157-79-5) is a chemical compound with the molecular formula C5H10ClNO3 and a molecular weight of 173.55 g/mol. IUPAC name: 5-(15N)azanyl-4-oxo(1,2,3,4,5-13C5)pentanoic acid;hydrochloride. InChIKey: ZLHFONARZHCSET-BVNCJLROSA-N.
| Molecular formula | C5H10ClNO3 |
|---|---|
| Molecular weight | 173.55 g/mol |
| IUPAC name | 5-(15N)azanyl-4-oxo(1,2,3,4,5-13C5)pentanoic acid;hydrochloride |
| InChIKey | ZLHFONARZHCSET-BVNCJLROSA-N |
| SMILES | [13CH2]([13CH2][13C](=O)O)[13C](=O)[13CH2][15NH2].Cl |
Computed by PubChem (NCBI)