Products 187237-35-0
CAS 187237-35-0 appears in our catalog under these names: Methylaminolevulinate EP Impurity B-d2 HCl, 5–Aminolevulinic acid–d2 hydrochloride, 5-Aminolevulinic acid-d2 (hydrochloride), 91.20%. Offered by: Chemat Brand, GLPBio, MedChemExpress. Available pack sizes: on request, 1mg, 5mg, 5 mg, 1 mg.
5-amino-2,2-dideuterio-4-oxopentanoic acid;hydrochloride (CAS 187237-35-0) is a chemical compound with the molecular formula C5H10ClNO3 and a molecular weight of 169.60 g/mol. IUPAC name: 5-amino-2,2-dideuterio-4-oxopentanoic acid;hydrochloride. InChIKey: ZLHFONARZHCSET-IYPYQTRPSA-N.
| Molecular formula | C5H10ClNO3 |
|---|---|
| Molecular weight | 169.60 g/mol |
| IUPAC name | 5-amino-2,2-dideuterio-4-oxopentanoic acid;hydrochloride |
| InChIKey | ZLHFONARZHCSET-IYPYQTRPSA-N |
| SMILES | [2H]C([2H])(CC(=O)CN)C(=O)O.Cl |
Computed by PubChem (NCBI)