Products 1136839-60-5
CAS 1136839-60-5 is the registry number for Ape1/Ref-1 redox-IN-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
(E)-3-(3-chloro-1,4-dimethoxynaphthalen-2-yl)-2-methylprop-2-enoic acid (CAS 1136839-60-5) is a chemical compound with the molecular formula C16H15ClO4 and a molecular weight of 306.74 g/mol. IUPAC name: (E)-3-(3-chloro-1,4-dimethoxynaphthalen-2-yl)-2-methylprop-2-enoic acid. InChIKey: MLKANVRWIYIWBU-CMDGGOBGSA-N.
| Molecular formula | C16H15ClO4 |
|---|---|
| Molecular weight | 306.74 g/mol |
| IUPAC name | (E)-3-(3-chloro-1,4-dimethoxynaphthalen-2-yl)-2-methylprop-2-enoic acid |
| InChIKey | MLKANVRWIYIWBU-CMDGGOBGSA-N |
| SMILES | C/C(=C\C1=C(C2=CC=CC=C2C(=C1Cl)OC)OC)/C(=O)O |
Computed by PubChem (NCBI)