Products 2648585-77-5
CAS 2648585-77-5 is the registry number for methyl (5S)-5-(8-chloro-1-naphthyl)-5-hydroxy-3-oxo-pentanoate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl (5S)-5-(8-chloronaphthalen-1-yl)-5-hydroxy-3-oxopentanoate (CAS 2648585-77-5) is a chemical compound with the molecular formula C16H15ClO4 and a molecular weight of 306.74 g/mol. IUPAC name: methyl (5S)-5-(8-chloronaphthalen-1-yl)-5-hydroxy-3-oxopentanoate. InChIKey: XWSHITUOYALJED-AWEZNQCLSA-N.
| Molecular formula | C16H15ClO4 |
|---|---|
| Molecular weight | 306.74 g/mol |
| IUPAC name | methyl (5S)-5-(8-chloronaphthalen-1-yl)-5-hydroxy-3-oxopentanoate |
| InChIKey | XWSHITUOYALJED-AWEZNQCLSA-N |
| SMILES | COC(=O)CC(=O)C[C@@H](C1=CC=CC2=C1C(=CC=C2)Cl)O |
Computed by PubChem (NCBI)