Products 2367002-58-0

CAS 2367002-58-0 is the registry number for 2-(5-Chloro-2-((4-methoxybenzyl)oxy)phenyl)acetic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

2-[5-chloro-2-[(4-methoxyphenyl)methoxy]phenyl]acetic acid (CAS 2367002-58-0) is a chemical compound with the molecular formula C16H15ClO4 and a molecular weight of 306.74 g/mol. IUPAC name: 2-[5-chloro-2-[(4-methoxyphenyl)methoxy]phenyl]acetic acid. InChIKey: WQPZDRWQQSUGFS-UHFFFAOYSA-N.

Identity
Molecular formulaC16H15ClO4
Molecular weight306.74 g/mol
IUPAC name2-[5-chloro-2-[(4-methoxyphenyl)methoxy]phenyl]acetic acid
InChIKeyWQPZDRWQQSUGFS-UHFFFAOYSA-N
SMILESCOC1=CC=C(C=C1)COC2=C(C=C(C=C2)Cl)CC(=O)O

Computed by PubChem (NCBI)