CAS 1820711-92-9 is the registry number for methyl 2-chloro-4-(3,5-dimethoxyphenyl)benzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Methyl 2-chloro-4-(3,5-dimethoxyphenyl)benzoate (CAS 1820711-92-9) is a chemical compound with the molecular formula C16H15ClO4 and a molecular weight of 306.74 g/mol. IUPAC name: methyl 2-chloro-4-(3,5-dimethoxyphenyl)benzoate. InChIKey: MKMZODYMMQANJF-UHFFFAOYSA-N.
| Molecular formula | C16H15ClO4 |
|---|---|
| Molecular weight | 306.74 g/mol |
| IUPAC name | methyl 2-chloro-4-(3,5-dimethoxyphenyl)benzoate |
| InChIKey | MKMZODYMMQANJF-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1)C2=CC(=C(C=C2)C(=O)OC)Cl)OC |
Computed by PubChem (NCBI)