Products 438218-99-6

CAS 438218-99-6 is the registry number for 3-((4-Chloro-3-methylphenoxy)methyl)-4-methoxybenzoic acid. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.

Structural formula: {0} (CAS {1})

3-[(4-chloro-3-methylphenoxy)methyl]-4-methoxybenzoic acid (CAS 438218-99-6) is a chemical compound with the molecular formula C16H15ClO4 and a molecular weight of 306.74 g/mol. IUPAC name: 3-[(4-chloro-3-methylphenoxy)methyl]-4-methoxybenzoic acid. InChIKey: VLPQYVCWRMLLEA-UHFFFAOYSA-N.

Identity
Molecular formulaC16H15ClO4
Molecular weight306.74 g/mol
IUPAC name3-[(4-chloro-3-methylphenoxy)methyl]-4-methoxybenzoic acid
InChIKeyVLPQYVCWRMLLEA-UHFFFAOYSA-N
SMILESCC1=C(C=CC(=C1)OCC2=C(C=CC(=C2)C(=O)O)OC)Cl

Computed by PubChem (NCBI)