Products 113707-87-2
CAS 113707-87-2 appears in our catalog under these names: 7-Hydrazinyl-4-methyl-2H-chromen-2-one, 97%, Coumarin hydrazine, Coumarin hydrazine, Coumarin hydrazine, 97.88%, Coumarin hydrazine, 97%. Offered by: BLDpharm, TargetMol, GLPBio, MedChemExpress, Ambeed. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50 mg, 25 mg, 100 mg, 10 mg.
7-hydrazinyl-4-methylchromen-2-one (CAS 113707-87-2) is a chemical compound with the molecular formula C10H10N2O2 and a molecular weight of 190.20 g/mol. IUPAC name: 7-hydrazinyl-4-methylchromen-2-one. InChIKey: ZGALTRTXIDNBJL-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O2 |
|---|---|
| Molecular weight | 190.20 g/mol |
| IUPAC name | 7-hydrazinyl-4-methylchromen-2-one |
| InChIKey | ZGALTRTXIDNBJL-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)OC2=C1C=CC(=C2)NN |
Computed by PubChem (NCBI)