CAS 113721-77-0 appears in our catalog under these names: 1-(Trifluoromethyl)-1,2,3,4-tetrahydroisoquinoline, 95%, 1-(Trifluoromethyl)-1,2,3,4-tetrahydroisoquinoline. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
1-(trifluoromethyl)-1,2,3,4-tetrahydroisoquinoline (CAS 113721-77-0) is a chemical compound with the molecular formula C10H10F3N and a molecular weight of 201.19 g/mol. IUPAC name: 1-(trifluoromethyl)-1,2,3,4-tetrahydroisoquinoline. InChIKey: KHCNWJQUAKFPOQ-UHFFFAOYSA-N.
| Molecular formula | C10H10F3N |
|---|---|
| Molecular weight | 201.19 g/mol |
| IUPAC name | 1-(trifluoromethyl)-1,2,3,4-tetrahydroisoquinoline |
| InChIKey | KHCNWJQUAKFPOQ-UHFFFAOYSA-N |
| SMILES | C1CNC(C2=CC=CC=C21)C(F)(F)F |
Computed by PubChem (NCBI)