CAS 75414-00-5 appears in our catalog under these names: 6-(Trifluoromethyl)-1,2,3,4-tetrahydroquinoline, 95%, 6-Trifluoromethyl-1,2,3,4-tetrahydroquinoline, 97%, 97%, 6-(TRIFLUOROMETHYL)-1,2,3,4-TETRAHYDROQUINOLINE, 97%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100mg, 500mg.
6-(trifluoromethyl)-1,2,3,4-tetrahydroquinoline (CAS 75414-00-5) is a chemical compound with the molecular formula C10H10F3N and a molecular weight of 201.19 g/mol. IUPAC name: 6-(trifluoromethyl)-1,2,3,4-tetrahydroquinoline. InChIKey: SQJQPDGTZCRFBC-UHFFFAOYSA-N.
| Molecular formula | C10H10F3N |
|---|---|
| Molecular weight | 201.19 g/mol |
| IUPAC name | 6-(trifluoromethyl)-1,2,3,4-tetrahydroquinoline |
| InChIKey | SQJQPDGTZCRFBC-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C=CC(=C2)C(F)(F)F)NC1 |
Computed by PubChem (NCBI)