CAS 199678-32-5 appears in our catalog under these names: 7-(Trifluoromethyl)-1,2,3,4-tetrahydroisoquinoline, 95%, 7-(Trifluoromethyl)-1,2,3,4-tetrahydroisoquinoline, 98%, 7–(Trifluoromethyl)–1,2,3,4–tetrahydroisoquinoline, 7-(Trifluoromethyl)-1,2,3,4-tetrahydroisoquinoline, ≥98%, ≥98%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat. Available pack sizes: 1g, 5g, 100mg, 250mg.
7-(trifluoromethyl)-1,2,3,4-tetrahydroisoquinoline (CAS 199678-32-5) is a chemical compound with the molecular formula C10H10F3N and a molecular weight of 201.19 g/mol. IUPAC name: 7-(trifluoromethyl)-1,2,3,4-tetrahydroisoquinoline. InChIKey: NGQHLYGRTFVUEM-UHFFFAOYSA-N.
| Molecular formula | C10H10F3N |
|---|---|
| Molecular weight | 201.19 g/mol |
| IUPAC name | 7-(trifluoromethyl)-1,2,3,4-tetrahydroisoquinoline |
| InChIKey | NGQHLYGRTFVUEM-UHFFFAOYSA-N |
| SMILES | C1CNCC2=C1C=CC(=C2)C(F)(F)F |
Computed by PubChem (NCBI)