CAS 2048224-51-5 is the registry number for 3-((2,3-Difluorophenyl)fluoromethyl)azetidine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-[(2,3-difluorophenyl)-fluoromethyl]azetidine (CAS 2048224-51-5) is a chemical compound with the molecular formula C10H10F3N and a molecular weight of 201.19 g/mol. IUPAC name: 3-[(2,3-difluorophenyl)-fluoromethyl]azetidine. InChIKey: RLGIEZBEUYYQDX-UHFFFAOYSA-N.
| Molecular formula | C10H10F3N |
|---|---|
| Molecular weight | 201.19 g/mol |
| IUPAC name | 3-[(2,3-difluorophenyl)-fluoromethyl]azetidine |
| InChIKey | RLGIEZBEUYYQDX-UHFFFAOYSA-N |
| SMILES | C1C(CN1)C(C2=C(C(=CC=C2)F)F)F |
Computed by PubChem (NCBI)