Products 200711-22-4
CAS 200711-22-4 appears in our catalog under these names: 5-Methyl-6-(trifluoromethyl)indoline, 95%, 5-Methyl-6-(trifluoromethyl)indoline 98%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
5-methyl-6-(trifluoromethyl)-2,3-dihydro-1H-indole (CAS 200711-22-4) is a chemical compound with the molecular formula C10H10F3N and a molecular weight of 201.19 g/mol. IUPAC name: 5-methyl-6-(trifluoromethyl)-2,3-dihydro-1H-indole. InChIKey: SJDNGKSDFPRJQU-UHFFFAOYSA-N.
| Molecular formula | C10H10F3N |
|---|---|
| Molecular weight | 201.19 g/mol |
| IUPAC name | 5-methyl-6-(trifluoromethyl)-2,3-dihydro-1H-indole |
| InChIKey | SJDNGKSDFPRJQU-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1C(F)(F)F)NCC2 |
Computed by PubChem (NCBI)