CAS 113730-55-5 is the registry number for Ethyl 7-chloro-2,3-dihydrobenzofuran-2-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
Ethyl 7-chloro-2,3-dihydro-1-benzofuran-2-carboxylate (CAS 113730-55-5) is a chemical compound with the molecular formula C11H11ClO3 and a molecular weight of 226.65 g/mol. IUPAC name: ethyl 7-chloro-2,3-dihydro-1-benzofuran-2-carboxylate. InChIKey: WXIWFFCWJBQQKX-UHFFFAOYSA-N.
| Molecular formula | C11H11ClO3 |
|---|---|
| Molecular weight | 226.65 g/mol |
| IUPAC name | ethyl 7-chloro-2,3-dihydro-1-benzofuran-2-carboxylate |
| InChIKey | WXIWFFCWJBQQKX-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1CC2=C(O1)C(=CC=C2)Cl |
Computed by PubChem (NCBI)