CAS 1780867-35-7 is the registry number for Cyclopropanecarboxylic acid, 1-[(4-chlorophenoxy)methyl], 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
1-[(4-chlorophenoxy)methyl]cyclopropane-1-carboxylic acid (CAS 1780867-35-7) is a chemical compound with the molecular formula C11H11ClO3 and a molecular weight of 226.65 g/mol. IUPAC name: 1-[(4-chlorophenoxy)methyl]cyclopropane-1-carboxylic acid. InChIKey: FFQJTZHMVYQUBW-UHFFFAOYSA-N.
| Molecular formula | C11H11ClO3 |
|---|---|
| Molecular weight | 226.65 g/mol |
| IUPAC name | 1-[(4-chlorophenoxy)methyl]cyclopropane-1-carboxylic acid |
| InChIKey | FFQJTZHMVYQUBW-UHFFFAOYSA-N |
| SMILES | C1CC1(COC2=CC=C(C=C2)Cl)C(=O)O |
Computed by PubChem (NCBI)