CAS 1137826-05-1 appears in our catalog under these names: 6-Hydroxyquinoline-3-carboxylic acid, 95%, 6–Hydroxyquinoline–3–carboxylic acid, 6-Hydroxyquinoline-3-carboxylic acid, 95%, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 10g, 5g, 250mg, 100mg.
6-hydroxyquinoline-3-carboxylic acid (CAS 1137826-05-1) is a chemical compound with the molecular formula C10H7NO3 and a molecular weight of 189.17 g/mol. IUPAC name: 6-hydroxyquinoline-3-carboxylic acid. InChIKey: OKIIDYYKVMNMGL-UHFFFAOYSA-N.
| Molecular formula | C10H7NO3 |
|---|---|
| Molecular weight | 189.17 g/mol |
| IUPAC name | 6-hydroxyquinoline-3-carboxylic acid |
| InChIKey | OKIIDYYKVMNMGL-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC=C(C=C2C=C1O)C(=O)O |
Computed by PubChem (NCBI)